C21H28O2 — CID 143236815
15-hydroxy-2,16-dimethyltetracyclo[8.8.1.02,7.011,16]nonadeca-1(18),6,8-trien-5-one (PubChem CID 143236815) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 15-hydroxy-2,16-dimethyltetracyclo[8.8.1.02,7.011,16]nonadeca-1(18),6,8-trien-5-one.
| Compound Name | 15-hydroxy-2,16-dimethyltetracyclo[8.8.1.02,7.011,16]nonadeca-1(18),6,8-trien-5-one |
|---|---|
| PubChem CID | 143236815 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 15-hydroxy-2,16-dimethyltetracyclo[8.8.1.02,7.011,16]nonadeca-1(18),6,8-trien-5-one |
| SMILES | CC12CCC(=O)C=C1C=CC1CC2=CCC2(C)C(O)CCCC12 |
| InChI | InChI=1S/C21H28O2/c1-20-11-9-17(22)13-15(20)7-6-14-12-16(20)8-10-21(2)18(14)4-3-5-19(21)23/h6-8,13-14,18-19,23H,3-5,9-12H2,1-2H3 |
| InChIKey | HGEPMFOAPKRYQS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|