C28H42O — CID 143166259
(4bS,6aR,7R,10aS)-4a,6a-dimethyl-7-[(2R)-6-methylhept-5-en-2-yl]-4,4b,5,6,7,8,9,10,10a,10b-decahydro-3H-chrysen-2-one (PubChem CID 143166259) has the molecular formula C28H42O and a molecular weight of 394.64 g/mol. Its IUPAC name is (4bS,6aR,7R,10aS)-4a,6a-dimethyl-7-[(2R)-6-methylhept-5-en-2-yl]-4,4b,5,6,7,8,9,10,10a,10b-decahydro-3H-chrysen-2-one.
| Compound Name | (4bS,6aR,7R,10aS)-4a,6a-dimethyl-7-[(2R)-6-methylhept-5-en-2-yl]-4,4b,5,6,7,8,9,10,10a,10b-decahydro-3H-chrysen-2-one |
|---|---|
| PubChem CID | 143166259 |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | (4bS,6aR,7R,10aS)-4a,6a-dimethyl-7-[(2R)-6-methylhept-5-en-2-yl]-4,4b,5,6,7,8,9,10,10a,10b-decahydro-3H-chrysen-2-one |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CCC[C@H]2C3C=CC4=CC(=O)CCC4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H42O/c1-19(2)8-6-9-20(3)24-10-7-11-25-23-13-12-21-18-22(29)14-16-27(21,4)26(23)15-17-28(24,25)5/h8,12-13,18,20,23-26H,6-7,9-11,14-17H2,1-5H3/t20-,23?,24-,25+,26+,27?,28-/m1/s1 |
| InChIKey | PFPNMGWVRZQQQG-KMTRPEPDSA-N |
| XLogP | 7.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|