C25H36O2 — CID 58752733
10,13-dimethyl-17-(5-oxohexan-2-yl)-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 58752733) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 10,13-dimethyl-17-(5-oxohexan-2-yl)-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 10,13-dimethyl-17-(5-oxohexan-2-yl)-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 58752733 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 10,13-dimethyl-17-(5-oxohexan-2-yl)-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)CCC(C)C1CCC2C3C=CC4=CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H36O2/c1-16(5-6-17(2)26)21-9-10-22-20-8-7-18-15-19(27)11-13-24(18,3)23(20)12-14-25(21,22)4/h7-8,15-16,20-23H,5-6,9-14H2,1-4H3 |
| InChIKey | BNAYLCBHQDNGCF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |