C25H36 — CID 143915305
(16R)-17-but-1-en-2-yl-10,13,16-trimethyl-3-methylidene-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 143915305) has the molecular formula C25H36 and a molecular weight of 336.56 g/mol. Its IUPAC name is (16R)-17-but-1-en-2-yl-10,13,16-trimethyl-3-methylidene-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (16R)-17-but-1-en-2-yl-10,13,16-trimethyl-3-methylidene-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 143915305 |
| Molecular Formula | C25H36 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | (16R)-17-but-1-en-2-yl-10,13,16-trimethyl-3-methylidene-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C=C1C=C2CCC3C(=CCC4(C)C3C[C@@H](C)C4C(=C)CC)C2(C)CC1 |
| InChI | InChI=1S/C25H36/c1-7-17(3)23-18(4)15-22-20-9-8-19-14-16(2)10-12-24(19,5)21(20)11-13-25(22,23)6/h11,14,18,20,22-23H,2-3,7-10,12-13,15H2,1,4-6H3/t18-,20?,22?,23?,24?,25?/m1/s1 |
| InChIKey | SNHGJGXDMFUBJP-UCMHHUBYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|