C30H48 — CID 143915269
(10S,13S)-17-but-1-en-2-yl-10,13-dimethyl-3-methylidene-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene;ethane;2-methylprop-1-ene (PubChem CID 143915269) has the molecular formula C30H48 and a molecular weight of 408.71 g/mol. Its IUPAC name is (10S,13S)-17-but-1-en-2-yl-10,13-dimethyl-3-methylidene-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene;ethane;2-methylprop-1-ene.
| Compound Name | (10S,13S)-17-but-1-en-2-yl-10,13-dimethyl-3-methylidene-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene;ethane;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143915269 |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | (10S,13S)-17-but-1-en-2-yl-10,13-dimethyl-3-methylidene-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene;ethane;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C1C=C2CCC3C(=CC[C@]4(C)C(C(=C)CC)CCC34)[C@@]2(C)CC1.CC |
| InChI | InChI=1S/C24H34.C4H8.C2H6/c1-6-17(3)20-9-10-21-19-8-7-18-15-16(2)11-13-23(18,4)22(19)12-14-24(20,21)5;1-4(2)3;1-2/h12,15,19-21H,2-3,6-11,13-14H2,1,4-5H3;1H2,2-3H3;1-2H3/t19?,20?,21?,23-,24+;;/m0../s1 |
| InChIKey | ZHKHKLDPLLOPFQ-QOZQYANLSA-N |
| XLogP | 9.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|