C22H26O3 — CID 42642633
(1'R,2'R,3'R,5S,5'R,7'S,10'S,11'R)-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2,14'-dione (PubChem CID 42642633) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (1'R,2'R,3'R,5S,5'R,7'S,10'S,11'R)-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2,14'-dione.
| Compound Name | (1'R,2'R,3'R,5S,5'R,7'S,10'S,11'R)-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2,14'-dione |
|---|---|
| PubChem CID | 42642633 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (1'R,2'R,3'R,5S,5'R,7'S,10'S,11'R)-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2,14'-dione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@H]43)[C@@H]1[C@H]1C[C@H]1[C@@]21C=CC(=O)O1 |
| InChI | InChI=1S/C22H26O3/c1-21-8-6-15-14-5-3-13(23)10-12(14)2-4-16(15)20(21)17-11-18(17)22(21)9-7-19(24)25-22/h7,9-10,14-18,20H,2-6,8,11H2,1H3/t14-,15+,16+,17-,18+,20+,21-,22-/m0/s1 |
| InChIKey | FSMOMJIWIGZZPC-YPGJWYINSA-N |
| XLogP | 3.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |