C23H27NO3 — CID 58109787
(5S,7'E,10'R,14'S)-7'-hydroxyimino-14'-methylspiro[furan-5,15'-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene]-2-one (PubChem CID 58109787) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is (5S,7'E,10'R,14'S)-7'-hydroxyimino-14'-methylspiro[furan-5,15'-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene]-2-one.
| Compound Name | (5S,7'E,10'R,14'S)-7'-hydroxyimino-14'-methylspiro[furan-5,15'-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene]-2-one |
|---|---|
| PubChem CID | 58109787 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (5S,7'E,10'R,14'S)-7'-hydroxyimino-14'-methylspiro[furan-5,15'-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene]-2-one |
| SMILES | C[C@]12CCC3C(C4CC4C4=C/C(=N/O)CC[C@@H]43)C1C1CC1[C@@]21C=CC(=O)O1 |
| InChI | InChI=1S/C23H27NO3/c1-22-6-4-13-12-3-2-11(24-26)8-14(12)15-9-16(15)20(13)21(22)17-10-18(17)23(22)7-5-19(25)27-23/h5,7-8,12-13,15-18,20-21,26H,2-4,6,9-10H2,1H3/b24-11+/t12-,13?,15?,16?,17?,18?,20?,21?,22+,23+/m1/s1 |
| InChIKey | CXEXDLHEHINMMX-PQIBQXIUSA-N |
| XLogP | 3.95 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|