C22H27NO3 — CID 58109791
(5S,7'S,11'R,14'E)-14'-hydroxyimino-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2-one (PubChem CID 58109791) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (5S,7'S,11'R,14'E)-14'-hydroxyimino-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2-one.
| Compound Name | (5S,7'S,11'R,14'E)-14'-hydroxyimino-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2-one |
|---|---|
| PubChem CID | 58109791 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (5S,7'S,11'R,14'E)-14'-hydroxyimino-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2-one |
| SMILES | C[C@]12CCC3C(CCC4=C/C(=N/O)CC[C@@H]43)C1C1CC1[C@@]21C=CC(=O)O1 |
| InChI | InChI=1S/C22H27NO3/c1-21-8-6-15-14-5-3-13(23-25)10-12(14)2-4-16(15)20(21)17-11-18(17)22(21)9-7-19(24)26-22/h7,9-10,14-18,20,25H,2-6,8,11H2,1H3/b23-13+/t14-,15?,16?,17?,18?,20?,21-,22-/m0/s1 |
| InChIKey | FZGRRSLUYVXWDT-ZLZXEJCBSA-N |
| XLogP | 4.10 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|