C24H29NO3 — CID 58109792
CID 58109792 (PubChem CID 58109792) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol.
| Compound Name | CID 58109792 |
|---|---|
| PubChem CID | 58109792 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | — |
| SMILES | C[C@]12CCC3C(CC4(CC4)C4=C/C(=N/O)CC[C@@H]43)C1C1CC1[C@@]21C=CC(=O)O1 |
| InChI | InChI=1S/C24H29NO3/c1-22-6-4-14-15-3-2-13(25-27)10-18(15)23(8-9-23)12-17(14)21(22)16-11-19(16)24(22)7-5-20(26)28-24/h5,7,10,14-17,19,21,27H,2-4,6,8-9,11-12H2,1H3/b25-13+/t14?,15-,16?,17?,19?,21?,22+,24+/m1/s1 |
| InChIKey | GPJUJRCPHLFECR-SEOADOQKSA-N |
| XLogP | 4.49 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|