C23H29NO2 — CID 58115322
CID 58115322 (PubChem CID 58115322) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol.
| Compound Name | CID 58115322 |
|---|---|
| PubChem CID | 58115322 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | — |
| SMILES | [H]/N=C1/C=C2[C@H](CC1)C1CC[C@@]3(C)C(CC[C@@]34C=CC(=O)O4)C1CC21CC1 |
| InChI | InChI=1S/C23H29NO2/c1-21-7-4-15-16-3-2-14(24)12-19(16)22(10-11-22)13-17(15)18(21)5-8-23(21)9-6-20(25)26-23/h6,9,12,15-18,24H,2-5,7-8,10-11,13H2,1H3/b24-14+/t15?,16-,17?,18?,21+,23-/m1/s1 |
| InChIKey | BKYBAXFIOCBWGN-DLKBNKAASA-N |
| XLogP | 4.82 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|