C23H29NO2 — CID 123444569
(10R,13S,17R)-3-amino-7-ethenyl-13-methylspiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-furan]-2'-one (PubChem CID 123444569) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (10R,13S,17R)-3-amino-7-ethenyl-13-methylspiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-furan]-2'-one.
| Compound Name | (10R,13S,17R)-3-amino-7-ethenyl-13-methylspiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-furan]-2'-one |
|---|---|
| PubChem CID | 123444569 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (10R,13S,17R)-3-amino-7-ethenyl-13-methylspiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-furan]-2'-one |
| SMILES | C=CC1C=C2C=C(N)CC[C@@H]2C2CC[C@@]3(C)C(CC[C@@]34C=CC(=O)O4)C12 |
| InChI | InChI=1S/C23H29NO2/c1-3-14-12-15-13-16(24)4-5-17(15)18-6-9-22(2)19(21(14)18)7-10-23(22)11-8-20(25)26-23/h3,8,11-14,17-19,21H,1,4-7,9-10,24H2,2H3/t14?,17-,18?,19?,21?,22-,23+/m0/s1 |
| InChIKey | RLRZEYAFWRHRLV-SHWFBYHASA-N |
| XLogP | 4.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|