C23H31NO2 — CID 91580887
(10R,13S,17R)-7-ethenyl-13-methyl-3-nitrosospiro[2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan] (PubChem CID 91580887) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (10R,13S,17R)-7-ethenyl-13-methyl-3-nitrosospiro[2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan].
| Compound Name | (10R,13S,17R)-7-ethenyl-13-methyl-3-nitrosospiro[2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan] |
|---|---|
| PubChem CID | 91580887 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (10R,13S,17R)-7-ethenyl-13-methyl-3-nitrosospiro[2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan] |
| SMILES | C=CC1C=C2CC(N=O)CC[C@@H]2C2CC[C@@]3(C)C(CC[C@@]34C=CCO4)C12 |
| InChI | InChI=1S/C23H31NO2/c1-3-15-13-16-14-17(24-25)5-6-18(16)19-7-10-22(2)20(21(15)19)8-11-23(22)9-4-12-26-23/h3-4,9,13,15,17-21H,1,5-8,10-12,14H2,2H3/t15?,17?,18-,19?,20?,21?,22-,23-/m0/s1 |
| InChIKey | LOKWHYBCZSTOGG-RYBLQBTISA-N |
| XLogP | 5.43 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|