C23H29NO2 — CID 123294097
(5S,10'R,14'S)-14'-methyl-7'-nitrosospiro[2H-furan-5,15'-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene] (PubChem CID 123294097) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (5S,10'R,14'S)-14'-methyl-7'-nitrosospiro[2H-furan-5,15'-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene].
| Compound Name | (5S,10'R,14'S)-14'-methyl-7'-nitrosospiro[2H-furan-5,15'-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene] |
|---|---|
| PubChem CID | 123294097 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (5S,10'R,14'S)-14'-methyl-7'-nitrosospiro[2H-furan-5,15'-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene] |
| SMILES | C[C@]12CCC3C(C4CC4C4=CC(N=O)CC[C@@H]43)C1C1CC1[C@@]21C=CCO1 |
| InChI | InChI=1S/C23H29NO2/c1-22-7-5-14-13-4-3-12(24-25)9-15(13)16-10-17(16)20(14)21(22)18-11-19(18)23(22)6-2-8-26-23/h2,6,9,12-14,16-21H,3-5,7-8,10-11H2,1H3/t12?,13-,14?,16?,17?,18?,19?,20?,21?,22+,23+/m1/s1 |
| InChIKey | MFDWXTVEHWCNEQ-AKLRMHTDSA-N |
| XLogP | 4.73 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|