C23H28O3 — CID 58109813
(5S,7'S,11'R)-7',18'-dimethylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2,14'-dione (PubChem CID 58109813) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is (5S,7'S,11'R)-7',18'-dimethylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2,14'-dione.
| Compound Name | (5S,7'S,11'R)-7',18'-dimethylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2,14'-dione |
|---|---|
| PubChem CID | 58109813 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (5S,7'S,11'R)-7',18'-dimethylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2,14'-dione |
| SMILES | CC1CC2=CC(=O)CC[C@@H]2C2CC[C@@]3(C)C(C4CC4[C@@]34C=CC(=O)O4)C12 |
| InChI | InChI=1S/C23H28O3/c1-12-9-13-10-14(24)3-4-15(13)16-5-7-22(2)21(20(12)16)17-11-18(17)23(22)8-6-19(25)26-23/h6,8,10,12,15-18,20-21H,3-5,7,9,11H2,1-2H3/t12?,15-,16?,17?,18?,20?,21?,22-,23-/m0/s1 |
| InChIKey | FZMUIXFFWKZFOF-IOMDOBBPSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |