C24H28O3 — CID 123624735
(1'S,2'S,3'R,5S,5'R,7'S,10'S,11'R,18'R)-18'-ethenyl-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-ene]-2,14'-dione (PubChem CID 123624735) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (1'S,2'S,3'R,5S,5'R,7'S,10'S,11'R,18'R)-18'-ethenyl-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-ene]-2,14'-dione.
| Compound Name | (1'S,2'S,3'R,5S,5'R,7'S,10'S,11'R,18'R)-18'-ethenyl-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-ene]-2,14'-dione |
|---|---|
| PubChem CID | 123624735 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (1'S,2'S,3'R,5S,5'R,7'S,10'S,11'R,18'R)-18'-ethenyl-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-ene]-2,14'-dione |
| SMILES | C=C[C@H]1C=C2CC(=O)CC[C@@H]2[C@H]2CC[C@@]3(C)[C@@H]([C@H]4C[C@H]4[C@@]34C=CC(=O)O4)[C@H]12 |
| InChI | InChI=1S/C24H28O3/c1-3-13-10-14-11-15(25)4-5-16(14)17-6-8-23(2)22(21(13)17)18-12-19(18)24(23)9-7-20(26)27-24/h3,7,9-10,13,16-19,21-22H,1,4-6,8,11-12H2,2H3/t13-,16-,17+,18-,19+,21+,22-,23-,24-/m0/s1 |
| InChIKey | XXNBKQLZIOMPFB-CGTZZVBXSA-N |
| XLogP | 4.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|