C23H26O3 — CID 123450274
(5S,7'S)-7'-methyl-17'-methylidenespiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-2,14'-dione (PubChem CID 123450274) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is (5S,7'S)-7'-methyl-17'-methylidenespiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-2,14'-dione.
| Compound Name | (5S,7'S)-7'-methyl-17'-methylidenespiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-2,14'-dione |
|---|---|
| PubChem CID | 123450274 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (5S,7'S)-7'-methyl-17'-methylidenespiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-2,14'-dione |
| SMILES | C=C1CC2C(CC[C@@]3(C)C2C2CC2[C@@]32C=CC(=O)O2)C2=C1CC(=O)CC2 |
| InChI | InChI=1S/C23H26O3/c1-12-9-17-15(14-4-3-13(24)10-16(12)14)5-7-22(2)21(17)18-11-19(18)23(22)8-6-20(25)26-23/h6,8,15,17-19,21H,1,3-5,7,9-11H2,2H3/t15?,17?,18?,19?,21?,22-,23-/m0/s1 |
| InChIKey | HIWHMGZBHSDZFS-UZNJAQKFSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |