C24H28O3 — CID 123980503
CID 123980503 (PubChem CID 123980503) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol.
| Compound Name | CID 123980503 |
|---|---|
| PubChem CID | 123980503 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | — |
| SMILES | C[C@]12CCC3C4=C(CC(=O)CC4)C4(CC4)CC3C1C1CC1[C@@]21C=CC(=O)O1 |
| InChI | InChI=1S/C24H28O3/c1-22-6-4-14-15-3-2-13(25)10-18(15)23(8-9-23)12-17(14)21(22)16-11-19(16)24(22)7-5-20(26)27-24/h5,7,14,16-17,19,21H,2-4,6,8-12H2,1H3/t14?,16?,17?,19?,21?,22-,24-/m0/s1 |
| InChIKey | JUWXGNVBCFIYCC-QYVAYJTOSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|