C22H28O2 — CID 91602166
(13S,17R)-13-methyl-6-methylidenespiro[2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one (PubChem CID 91602166) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (13S,17R)-13-methyl-6-methylidenespiro[2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one.
| Compound Name | (13S,17R)-13-methyl-6-methylidenespiro[2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one |
|---|---|
| PubChem CID | 91602166 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (13S,17R)-13-methyl-6-methylidenespiro[2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one |
| SMILES | C=C1CC2C(CC[C@@]3(C)C2CC[C@@]32C=CCO2)C2=C1CC(=O)CC2 |
| InChI | InChI=1S/C22H28O2/c1-14-12-19-17(16-5-4-15(23)13-18(14)16)6-9-21(2)20(19)7-10-22(21)8-3-11-24-22/h3,8,17,19-20H,1,4-7,9-13H2,2H3/t17?,19?,20?,21-,22-/m0/s1 |
| InChIKey | AAWOKJBVTSZGFS-IYEUZKKOSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|