C23H30O2 — CID 91005991
CID 91005991 (PubChem CID 91005991) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol.
| Compound Name | CID 91005991 |
|---|---|
| PubChem CID | 91005991 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | — |
| SMILES | C[C@]12CC[C@@H]3C4=C(CC[C@H]3[C@@H]1CC1(CC1)[C@@]21C=CCO1)CC(=O)CC4 |
| InChI | InChI=1S/C23H30O2/c1-21-9-7-18-17-6-4-16(24)13-15(17)3-5-19(18)20(21)14-22(10-11-22)23(21)8-2-12-25-23/h2,8,18-20H,3-7,9-14H2,1H3/t18-,19-,20+,21+,23-/m1/s1 |
| InChIKey | XMQXFGAMLOBGLF-UNRHHUQTSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|