C21H26O2 — CID 91478963
(8R,9S,13S,14S,17R)-13-methylspiro[1,2,4,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one (PubChem CID 91478963) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-13-methylspiro[1,2,4,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one.
| Compound Name | (8R,9S,13S,14S,17R)-13-methylspiro[1,2,4,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one |
|---|---|
| PubChem CID | 91478963 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (8R,9S,13S,14S,17R)-13-methylspiro[1,2,4,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-2H-furan]-3-one |
| SMILES | C[C@]12CC[C@@H]3C4=C(C=C[C@H]3[C@@H]1CC[C@@]21C=CCO1)CC(=O)CC4 |
| InChI | InChI=1S/C21H26O2/c1-20-10-7-17-16-6-4-15(22)13-14(16)3-5-18(17)19(20)8-11-21(20)9-2-12-23-21/h2-3,5,9,17-19H,4,6-8,10-13H2,1H3/t17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | DEWKUIAMMGMLFO-MJCUULBUSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|