C22H29NO2 — CID 91017841
(13S,17R)-13-ethyl-3-nitrosospiro[2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan] (PubChem CID 91017841) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (13S,17R)-13-ethyl-3-nitrosospiro[2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan].
| Compound Name | (13S,17R)-13-ethyl-3-nitrosospiro[2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan] |
|---|---|
| PubChem CID | 91017841 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (13S,17R)-13-ethyl-3-nitrosospiro[2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan] |
| SMILES | CC[C@]12CCC3C4=C(C=CC3C1CC[C@@]21C=CCO1)CC(N=O)CC4 |
| InChI | InChI=1S/C22H29NO2/c1-2-21-11-8-18-17-7-5-16(23-24)14-15(17)4-6-19(18)20(21)9-12-22(21)10-3-13-25-22/h3-4,6,10,16,18-20H,2,5,7-9,11-14H2,1H3/t16?,18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | HXDWWJRAOKJDAB-AVUKQFATSA-N |
| XLogP | 5.33 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|