C23H33NO2 — CID 91470654
(13S,17R)-7-ethyl-13-methyl-3-nitrosospiro[2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan] (PubChem CID 91470654) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is (13S,17R)-7-ethyl-13-methyl-3-nitrosospiro[2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan].
| Compound Name | (13S,17R)-7-ethyl-13-methyl-3-nitrosospiro[2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan] |
|---|---|
| PubChem CID | 91470654 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (13S,17R)-7-ethyl-13-methyl-3-nitrosospiro[2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,5'-2H-furan] |
| SMILES | CCC1CC2=C(CCC(N=O)C2)C2CC[C@@]3(C)C(CC[C@@]34C=CCO4)C12 |
| InChI | InChI=1S/C23H33NO2/c1-3-15-13-16-14-17(24-25)5-6-18(16)19-7-10-22(2)20(21(15)19)8-11-23(22)9-4-12-26-23/h4,9,15,17,19-21H,3,5-8,10-14H2,1-2H3/t15?,17?,19?,20?,21?,22-,23-/m0/s1 |
| InChIKey | WBHMRBBXENORNM-HHMPJPDLSA-N |
| XLogP | 5.80 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|