C24H32O3 — CID 123675578
(13S,17R)-7,13-diethylspiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione (PubChem CID 123675578) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is (13S,17R)-7,13-diethylspiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione.
| Compound Name | (13S,17R)-7,13-diethylspiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione |
|---|---|
| PubChem CID | 123675578 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (13S,17R)-7,13-diethylspiro[1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2',3-dione |
| SMILES | CCC1CC2=C(CCC(=O)C2)C2CC[C@@]3(CC)C(CC[C@@]34C=CC(=O)O4)C12 |
| InChI | InChI=1S/C24H32O3/c1-3-15-13-16-14-17(25)5-6-18(16)19-7-10-23(4-2)20(22(15)19)8-11-24(23)12-9-21(26)27-24/h9,12,15,19-20,22H,3-8,10-11,13-14H2,1-2H3/t15?,19?,20?,22?,23-,24+/m0/s1 |
| InChIKey | BWJRDWBPCRTXEW-CWUGCRSBSA-N |
| XLogP | 5.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|