C23H29NO3 — CID 158031618
(5R,10'R,14'S)-14'-ethyl-7'-hydroxyiminospiro[furan-5,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-2-one (PubChem CID 158031618) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (5R,10'R,14'S)-14'-ethyl-7'-hydroxyiminospiro[furan-5,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-2-one.
| Compound Name | (5R,10'R,14'S)-14'-ethyl-7'-hydroxyiminospiro[furan-5,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-2-one |
|---|---|
| PubChem CID | 158031618 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (5R,10'R,14'S)-14'-ethyl-7'-hydroxyiminospiro[furan-5,15'-pentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-ene]-2-one |
| SMILES | CC[C@]12CCC3C(C4CC4C4=CC(=NO)CC[C@@H]43)C1CC[C@@]21C=CC(=O)O1 |
| InChI | InChI=1S/C23H29NO3/c1-2-22-8-5-15-14-4-3-13(24-26)11-16(14)17-12-18(17)21(15)19(22)6-9-23(22)10-7-20(25)27-23/h7,10-11,14-15,17-19,21,26H,2-6,8-9,12H2,1H3/t14-,15?,17?,18?,19?,21?,22+,23-/m1/s1 |
| InChIKey | FHGBHKIUEIKPDO-GDNDGWCVSA-N |
| XLogP | 4.49 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|