C70H85N3O10 — CID 172984538
CID 172984538 (PubChem CID 172984538) has the molecular formula C70H85N3O10 and a molecular weight of 1128.46 g/mol.
| Compound Name | CID 172984538 |
|---|---|
| PubChem CID | 172984538 |
| Molecular Formula | C70H85N3O10 |
| Molecular Weight | 1128.46 g/mol |
| Exact Mass | 1127.62 |
| IUPAC Name | — |
| SMILES | C[C@]12CCC3C(C4CC4C4=C/C(=N/O)CC[C@@H]43)C1C1CC1[C@@]21C=CC(=O)O1.C[C@]12CCC3C(CC(CO)C4=C/C(=N/O)CC[C@@H]43)C1C1CC1[C@@]21C=CC(=O)O1.C[C@]12CCC3C(CC4(CC4)C4=C/C(=N/O)CC[C@@H]43)C1C1CC1[C@@]21C=CC(=O)O1 |
| InChI | InChI=1S/C24H29NO3.C23H29NO4.C23H27NO3/c1-22-6-4-14-15-3-2-13(25-27)10-18(15)23(8-9-23)12-17(14)21(22)16-11-19(16)24(22)7-5-20(26)28-24;1-22-6-4-15-14-3-2-13(24-27)9-16(14)12(11-25)8-17(15)21(22)18-10-19(18)23(22)7-5-20(26)28-23;1-22-6-4-13-12-3-2-11(24-26)8-14(12)15-9-16(15)20(13)21(22)17-10-18(17)23(22)7-5-19(25)27-23/h5,7,10,14-17,19,21,27H,2-4,6,8-9,11-12H2,1H3;5,7,9,12,14-15,17-19,21,25,27H,2-4,6,8,10-11H2,1H3;5,7-8,12-13,15-18,20-21,26H,2-4,6,9-10H2,1H3/b25-13+;24-13+;24-11+/t14?,15-,16?,17?,19?,21?,22+,24+;12?,14-,15?,17?,18?,19?,21?,22+,23+;12-,13?,15?,16?,17?,18?,20?,21?,22+,23+/m111/s1 |
| InChIKey | KQVKXCQPMSNLML-PWBBGHCQSA-N |
| XLogP | 11.76 |
| TPSA | 196.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1128.46 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|