C23H29NO3 — CID 143827754
(5S,7'S,17'R)-17'-(hydroxymethyl)-14'-imino-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2-one (PubChem CID 143827754) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (5S,7'S,17'R)-17'-(hydroxymethyl)-14'-imino-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2-one.
| Compound Name | (5S,7'S,17'R)-17'-(hydroxymethyl)-14'-imino-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2-one |
|---|---|
| PubChem CID | 143827754 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (5S,7'S,17'R)-17'-(hydroxymethyl)-14'-imino-7'-methylspiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-2-one |
| SMILES | [H]/N=C1/C=C2C(CC1)C1CC[C@@]3(C)C(C1C[C@H]2CO)C1CC1[C@@]31C=CC(=O)O1 |
| InChI | InChI=1S/C23H29NO3/c1-22-6-4-15-14-3-2-13(24)9-16(14)12(11-25)8-17(15)21(22)18-10-19(18)23(22)7-5-20(26)27-23/h5,7,9,12,14-15,17-19,21,24-25H,2-4,6,8,10-11H2,1H3/b24-13+/t12-,14?,15?,17?,18?,19?,21?,22-,23-/m0/s1 |
| InChIKey | SVHFJUZOPVYERE-GCRAIDIZSA-N |
| XLogP | 3.50 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|