C22H29NO3 — CID 58115366
(10R,13S,17R)-6-(hydroxymethyl)-3-imino-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2'-one (PubChem CID 58115366) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (10R,13S,17R)-6-(hydroxymethyl)-3-imino-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2'-one.
| Compound Name | (10R,13S,17R)-6-(hydroxymethyl)-3-imino-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2'-one |
|---|---|
| PubChem CID | 58115366 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (10R,13S,17R)-6-(hydroxymethyl)-3-imino-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-furan]-2'-one |
| SMILES | [H]/N=C1/C=C2C(CO)CC3C(CC[C@@]4(C)C3CC[C@@]43C=CC(=O)O3)[C@H]2CC1 |
| InChI | InChI=1S/C22H29NO3/c1-21-7-4-16-15-3-2-14(23)11-17(15)13(12-24)10-18(16)19(21)5-8-22(21)9-6-20(25)26-22/h6,9,11,13,15-16,18-19,23-24H,2-5,7-8,10,12H2,1H3/b23-14+/t13?,15-,16?,18?,19?,21+,22-/m1/s1 |
| InChIKey | RLUDMFYITUWKNS-FIUMFGEKSA-N |
| XLogP | 3.65 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|