C23H29NO2 — CID 58115340
(10R,13S,17R)-13-ethyl-3-imino-6-methylidenespiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-furan]-2'-one (PubChem CID 58115340) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (10R,13S,17R)-13-ethyl-3-imino-6-methylidenespiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-furan]-2'-one.
| Compound Name | (10R,13S,17R)-13-ethyl-3-imino-6-methylidenespiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-furan]-2'-one |
|---|---|
| PubChem CID | 58115340 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (10R,13S,17R)-13-ethyl-3-imino-6-methylidenespiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-furan]-2'-one |
| SMILES | [H]/N=C1/C=C2C(=C)CC3C(CC[C@@]4(CC)C3CC[C@@]43C=CC(=O)O3)[C@H]2CC1 |
| InChI | InChI=1S/C23H29NO2/c1-3-22-9-6-17-16-5-4-15(24)13-18(16)14(2)12-19(17)20(22)7-10-23(22)11-8-21(25)26-23/h8,11,13,16-17,19-20,24H,2-7,9-10,12H2,1H3/b24-15+/t16-,17?,19?,20?,22+,23-/m1/s1 |
| InChIKey | JCMBIMYFTWCJOC-CXCIKPCFSA-N |
| XLogP | 4.99 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|