C28H43N — CID 143827736
buta-1,3-diene;ethane;13-ethenyl-16,17-dimethyl-6-methylidene-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine (PubChem CID 143827736) has the molecular formula C28H43N and a molecular weight of 393.66 g/mol. Its IUPAC name is buta-1,3-diene;ethane;13-ethenyl-16,17-dimethyl-6-methylidene-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine.
| Compound Name | buta-1,3-diene;ethane;13-ethenyl-16,17-dimethyl-6-methylidene-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 143827736 |
| Molecular Formula | C28H43N |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | buta-1,3-diene;ethane;13-ethenyl-16,17-dimethyl-6-methylidene-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-imine |
| SMILES | C=CC=C.CC.[H]/N=C1/C=C2C(=C)CC3C(CCC4(C=C)C(C)C(C)CC34)C2CC1 |
| InChI | InChI=1S/C22H31N.C4H6.C2H6/c1-5-22-9-8-18-17-7-6-16(23)12-19(17)14(3)10-20(18)21(22)11-13(2)15(22)4;1-3-4-2;1-2/h5,12-13,15,17-18,20-21,23H,1,3,6-11H2,2,4H3;3-4H,1-2H2;1-2H3/b23-16+;; |
| InChIKey | ZRDQEBOWESPXTA-CGSMVWNQSA-N |
| XLogP | 8.18 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|