C22H33N — CID 143827556
13-ethenyl-7-ethyl-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine (PubChem CID 143827556) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is 13-ethenyl-7-ethyl-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine.
| Compound Name | 13-ethenyl-7-ethyl-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 143827556 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 13-ethenyl-7-ethyl-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine |
| SMILES | [H]/N=C1/C=C2CC(CC)C3C(CCC4(C=C)C(C)CCC34)C2CC1 |
| InChI | InChI=1S/C22H33N/c1-4-15-12-16-13-17(23)7-8-18(16)19-10-11-22(5-2)14(3)6-9-20(22)21(15)19/h5,13-15,18-21,23H,2,4,6-12H2,1,3H3/b23-17+ |
| InChIKey | XPFPGKDJDJBHMX-HAVVHWLPSA-N |
| XLogP | 6.02 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|