C25H37NS — CID 143827615
ethenethiol;17-ethenyl-13-ethylspiro[1,2,6,7,8,9,10,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-16,1'-cyclopropane]-3-imine (PubChem CID 143827615) has the molecular formula C25H37NS and a molecular weight of 383.65 g/mol. Its IUPAC name is ethenethiol;17-ethenyl-13-ethylspiro[1,2,6,7,8,9,10,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-16,1'-cyclopropane]-3-imine.
| Compound Name | ethenethiol;17-ethenyl-13-ethylspiro[1,2,6,7,8,9,10,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-16,1'-cyclopropane]-3-imine |
|---|---|
| PubChem CID | 143827615 |
| Molecular Formula | C25H37NS |
| Molecular Weight | 383.65 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | ethenethiol;17-ethenyl-13-ethylspiro[1,2,6,7,8,9,10,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-16,1'-cyclopropane]-3-imine |
| SMILES | C=CS.[H]/N=C1/C=C2CCC3C(CCC4(CC)C3CC3(CC3)C4C=C)C2CC1 |
| InChI | InChI=1S/C23H33N.C2H4S/c1-3-21-22(11-12-22)14-20-19-7-5-15-13-16(24)6-8-17(15)18(19)9-10-23(20,21)4-2;1-2-3/h3,13,17-21,24H,1,4-12,14H2,2H3;2-3H,1H2/b24-16+; |
| InChIKey | JKHCPMACEWOPGI-RSOFWHLMSA-N |
| XLogP | 7.22 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|