C24H30O4 — CID 89075164
[(Z)-2-[(8R,9S,10R,13S,14S,17S)-13-ethyl-15,16-dimethylidene-3-oxo-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethenyl] hydrogen carbonate (PubChem CID 89075164) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is [(Z)-2-[(8R,9S,10R,13S,14S,17S)-13-ethyl-15,16-dimethylidene-3-oxo-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethenyl] hydrogen carbonate.
| Compound Name | [(Z)-2-[(8R,9S,10R,13S,14S,17S)-13-ethyl-15,16-dimethylidene-3-oxo-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 89075164 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [(Z)-2-[(8R,9S,10R,13S,14S,17S)-13-ethyl-15,16-dimethylidene-3-oxo-2,6,7,8,9,10,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethenyl] hydrogen carbonate |
| SMILES | C=C1C(=C)[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3CC[C@]2(CC)[C@@H]1/C=C\OC(=O)O |
| InChI | InChI=1S/C24H30O4/c1-4-24-11-9-19-18-8-6-17(25)13-16(18)5-7-20(19)22(24)15(3)14(2)21(24)10-12-28-23(26)27/h10,12-13,18-22H,2-9,11H2,1H3,(H,26,27)/b12-10-/t18-,19+,20+,21+,22-,24+/m0/s1 |
| InChIKey | LWAVGNLHWQHNBT-JEJMJWEZSA-N |
| XLogP | 5.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|