C20H27NO — CID 74388797
13-ethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 74388797) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 13-ethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | 13-ethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 74388797 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 13-ethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | CCC12CCC3C4CCC(=O)C=C4CCC3C1CCC2C#N |
| InChI | InChI=1S/C20H27NO/c1-2-20-10-9-17-16-7-5-15(22)11-13(16)3-6-18(17)19(20)8-4-14(20)12-21/h11,14,16-19H,2-10H2,1H3 |
| InChIKey | PZGUSVKBYPPQGW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |