C23H32INO2 — CID 89172704
(7-ethyl-14-imino-6-methyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-enyl) 2-iodoacetate (PubChem CID 89172704) has the molecular formula C23H32INO2 and a molecular weight of 481.42 g/mol. Its IUPAC name is (7-ethyl-14-imino-6-methyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-enyl) 2-iodoacetate.
| Compound Name | (7-ethyl-14-imino-6-methyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-enyl) 2-iodoacetate |
|---|---|
| PubChem CID | 89172704 |
| Molecular Formula | C23H32INO2 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | (7-ethyl-14-imino-6-methyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-enyl) 2-iodoacetate |
| SMILES | [H]/N=C1/C=C2CCC3C(CCC4(CC)C3C3CC3C4(C)OC(=O)CI)C2CC1 |
| InChI | InChI=1S/C23H32INO2/c1-3-23-9-8-16-15-7-5-14(25)10-13(15)4-6-17(16)21(23)18-11-19(18)22(23,2)27-20(26)12-24/h10,15-19,21,25H,3-9,11-12H2,1-2H3/b25-14+ |
| InChIKey | FYYSMHRQXYDKST-AFUMVMLFSA-N |
| XLogP | 5.56 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|