C22H30N2O — CID 87622623
(1R,2R,3R,5S,6S,7S,10S,11R,14Z)-7-ethyl-14-hydroxyimino-6-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile (PubChem CID 87622623) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is (1R,2R,3R,5S,6S,7S,10S,11R,14Z)-7-ethyl-14-hydroxyimino-6-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile.
| Compound Name | (1R,2R,3R,5S,6S,7S,10S,11R,14Z)-7-ethyl-14-hydroxyimino-6-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile |
|---|---|
| PubChem CID | 87622623 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | (1R,2R,3R,5S,6S,7S,10S,11R,14Z)-7-ethyl-14-hydroxyimino-6-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile |
| SMILES | CC[C@]12CC[C@H]3[C@@H](CCC4=C/C(=N\O)CC[C@@H]43)[C@@H]1[C@@H]1C[C@@H]1[C@]2(C)C#N |
| InChI | InChI=1S/C22H30N2O/c1-3-22-9-8-16-15-7-5-14(24-25)10-13(15)4-6-17(16)20(22)18-11-19(18)21(22,2)12-23/h10,15-20,25H,3-9,11H2,1-2H3/b24-14-/t15-,16+,17+,18+,19-,20+,21-,22-/m0/s1 |
| InChIKey | JQIGOUCIBDSJAL-JJILFHGPSA-N |
| XLogP | 5.17 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|