C23H29NO3 — CID 123179023
CID 123179023 (PubChem CID 123179023) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol.
| Compound Name | CID 123179023 |
|---|---|
| PubChem CID | 123179023 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | — |
| SMILES | C[C@]12CCC3C4CC/C(=N/O)C=C4CCC3C1CC1(CC1)[C@@]21C=CC(=O)O1 |
| InChI | InChI=1S/C23H29NO3/c1-21-8-6-17-16-5-3-15(24-26)12-14(16)2-4-18(17)19(21)13-22(10-11-22)23(21)9-7-20(25)27-23/h7,9,12,16-19,26H,2-6,8,10-11,13H2,1H3/b24-15-/t16?,17?,18?,19?,21-,23+/m0/s1 |
| InChIKey | UAEIMLOCXZAOKX-BAPWZRFFSA-N |
| XLogP | 4.63 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|