C23H32O3 — CID 70992356
(13R)-17-hydroxy-17-[(Z)-3-hydroxyprop-1-enyl]-13-methylspiro[2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-3-one (PubChem CID 70992356) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (13R)-17-hydroxy-17-[(Z)-3-hydroxyprop-1-enyl]-13-methylspiro[2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-3-one.
| Compound Name | (13R)-17-hydroxy-17-[(Z)-3-hydroxyprop-1-enyl]-13-methylspiro[2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-3-one |
|---|---|
| PubChem CID | 70992356 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (13R)-17-hydroxy-17-[(Z)-3-hydroxyprop-1-enyl]-13-methylspiro[2,6,7,8,9,10,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-16,1'-cyclopropane]-3-one |
| SMILES | C[C@@]12CCC3C4CCC(=O)C=C4CCC3C1CC1(CC1)C2(O)/C=C\CO |
| InChI | InChI=1S/C23H32O3/c1-21-9-7-18-17-6-4-16(25)13-15(17)3-5-19(18)20(21)14-22(10-11-22)23(21,26)8-2-12-24/h2,8,13,17-20,24,26H,3-7,9-12,14H2,1H3/b8-2-/t17?,18?,19?,20?,21-,23?/m1/s1 |
| InChIKey | GCMQKOREIHVTHB-AWYANJKOSA-N |
| XLogP | 3.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|