C22H30O3 — CID 123521287
(6S,7S)-6-hydroxy-6-(3-hydroxyprop-1-enyl)-7-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-en-14-one (PubChem CID 123521287) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (6S,7S)-6-hydroxy-6-(3-hydroxyprop-1-enyl)-7-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-en-14-one.
| Compound Name | (6S,7S)-6-hydroxy-6-(3-hydroxyprop-1-enyl)-7-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-en-14-one |
|---|---|
| PubChem CID | 123521287 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (6S,7S)-6-hydroxy-6-(3-hydroxyprop-1-enyl)-7-methylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-en-14-one |
| SMILES | C[C@]12CCC3C4CCC(=O)C=C4CCC3C1C1CC1[C@@]2(O)C=CCO |
| InChI | InChI=1S/C22H30O3/c1-21-9-7-16-15-6-4-14(24)11-13(15)3-5-17(16)20(21)18-12-19(18)22(21,25)8-2-10-23/h2,8,11,15-20,23,25H,3-7,9-10,12H2,1H3/t15?,16?,17?,18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | QJPAOSSLNLLRCG-NZPGJYTISA-N |
| XLogP | 3.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|