C25H38O3 — CID 70995919
4-[(1aS)-5a-ethyl-6-hydroxy-6-[(Z)-3-hydroxyprop-1-enyl]-2-methyl-1,1a,1b,2,3,4,5,6a-octahydrocyclopropa[a]inden-3-yl]-3-propan-2-ylcyclohex-2-en-1-one (PubChem CID 70995919) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 4-[(1aS)-5a-ethyl-6-hydroxy-6-[(Z)-3-hydroxyprop-1-enyl]-2-methyl-1,1a,1b,2,3,4,5,6a-octahydrocyclopropa[a]inden-3-yl]-3-propan-2-ylcyclohex-2-en-1-one.
| Compound Name | 4-[(1aS)-5a-ethyl-6-hydroxy-6-[(Z)-3-hydroxyprop-1-enyl]-2-methyl-1,1a,1b,2,3,4,5,6a-octahydrocyclopropa[a]inden-3-yl]-3-propan-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 70995919 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 4-[(1aS)-5a-ethyl-6-hydroxy-6-[(Z)-3-hydroxyprop-1-enyl]-2-methyl-1,1a,1b,2,3,4,5,6a-octahydrocyclopropa[a]inden-3-yl]-3-propan-2-ylcyclohex-2-en-1-one |
| SMILES | CCC12CCC(C3CCC(=O)C=C3C(C)C)C(C)C1[C@@H]1CC1C2(O)/C=C\CO |
| InChI | InChI=1S/C25H38O3/c1-5-24-11-9-18(19-8-7-17(27)13-20(19)15(2)3)16(4)23(24)21-14-22(21)25(24,28)10-6-12-26/h6,10,13,15-16,18-19,21-23,26,28H,5,7-9,11-12,14H2,1-4H3/b10-6-/t16?,18?,19?,21-,22?,23?,24?,25?/m1/s1 |
| InChIKey | YNQUQHUVYYULBG-ZGZIZPPSSA-N |
| XLogP | 4.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|