C24H30O2 — CID 143827768
(5S)-7'-ethyl-2-methylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-15,17-diene]-14'-one (PubChem CID 143827768) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is (5S)-7'-ethyl-2-methylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-15,17-diene]-14'-one.
| Compound Name | (5S)-7'-ethyl-2-methylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-15,17-diene]-14'-one |
|---|---|
| PubChem CID | 143827768 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (5S)-7'-ethyl-2-methylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-15,17-diene]-14'-one |
| SMILES | CCC12CCC3C4CCC(=O)C=C4C=CC3C1C1CC1[C@@]21C=CC(C)O1 |
| InChI | InChI=1S/C24H30O2/c1-3-23-10-9-18-17-7-5-16(25)12-15(17)4-6-19(18)22(23)20-13-21(20)24(23)11-8-14(2)26-24/h4,6,8,11-12,14,17-22H,3,5,7,9-10,13H2,1-2H3/t14?,17?,18?,19?,20?,21?,22?,23?,24-/m0/s1 |
| InChIKey | ODODPZRZYDBISH-DNQIXOKTSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|