C23H28O2 — CID 123860026
(3'S,5S,5'S,7'S)-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),17-diene]-14'-one (PubChem CID 123860026) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (3'S,5S,5'S,7'S)-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),17-diene]-14'-one.
| Compound Name | (3'S,5S,5'S,7'S)-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),17-diene]-14'-one |
|---|---|
| PubChem CID | 123860026 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (3'S,5S,5'S,7'S)-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-11(16),17-diene]-14'-one |
| SMILES | CC[C@]12CCC3C4=C(C=CC3C1C1C[C@@H]1[C@@]21C=CCO1)CC(=O)CC4 |
| InChI | InChI=1S/C23H28O2/c1-2-22-10-8-17-16-7-5-15(24)12-14(16)4-6-18(17)21(22)19-13-20(19)23(22)9-3-11-25-23/h3-4,6,9,17-21H,2,5,7-8,10-13H2,1H3/t17?,18?,19?,20-,21?,22-,23-/m0/s1 |
| InChIKey | JMZFFNAEGAQOLY-OCQMGLTQSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|