C26H35NO2 — CID 123645527
(5S,7'S)-18'-cyclopropyl-7'-ethyl-14'-nitrosospiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene] (PubChem CID 123645527) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is (5S,7'S)-18'-cyclopropyl-7'-ethyl-14'-nitrosospiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene].
| Compound Name | (5S,7'S)-18'-cyclopropyl-7'-ethyl-14'-nitrosospiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene] |
|---|---|
| PubChem CID | 123645527 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | (5S,7'S)-18'-cyclopropyl-7'-ethyl-14'-nitrosospiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene] |
| SMILES | CC[C@]12CCC3C4=C(CC(N=O)CC4)CC(C4CC4)C3C1C1CC1[C@@]21C=CCO1 |
| InChI | InChI=1S/C26H35NO2/c1-2-25-10-8-19-18-7-6-17(27-28)12-16(18)13-20(15-4-5-15)23(19)24(25)21-14-22(21)26(25)9-3-11-29-26/h3,9,15,17,19-24H,2,4-8,10-14H2,1H3/t17?,19?,20?,21?,22?,23?,24?,25-,26-/m0/s1 |
| InChIKey | SNESOPSBEJZPAD-UBOWTUQVSA-N |
| XLogP | 6.05 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|