C23H29NO3 — CID 123950990
(5S,7'S)-7'-ethyl-14'-nitrosospiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-2-one (PubChem CID 123950990) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (5S,7'S)-7'-ethyl-14'-nitrosospiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-2-one.
| Compound Name | (5S,7'S)-7'-ethyl-14'-nitrosospiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-2-one |
|---|---|
| PubChem CID | 123950990 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (5S,7'S)-7'-ethyl-14'-nitrosospiro[furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-11(16)-ene]-2-one |
| SMILES | CC[C@]12CCC3C4=C(CCC3C1C1CC1[C@@]21C=CC(=O)O1)CC(N=O)CC4 |
| InChI | InChI=1S/C23H29NO3/c1-2-22-9-7-16-15-6-4-14(24-26)11-13(15)3-5-17(16)21(22)18-12-19(18)23(22)10-8-20(25)27-23/h8,10,14,16-19,21H,2-7,9,11-12H2,1H3/t14?,16?,17?,18?,19?,21?,22-,23-/m0/s1 |
| InChIKey | DXXKIKMEYTWZDI-YZKARSBBSA-N |
| XLogP | 4.94 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|