C23H31NO2 — CID 58092661
(NE)-N-[(5S,7'S,11'R)-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-ylidene]hydroxylamine (PubChem CID 58092661) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (NE)-N-[(5S,7'S,11'R)-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(5S,7'S,11'R)-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 58092661 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (NE)-N-[(5S,7'S,11'R)-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-ylidene]hydroxylamine |
| SMILES | CC[C@]12CCC3C(CCC4=C/C(=N/O)CC[C@@H]43)C1C1CC1[C@@]21C=CCO1 |
| InChI | InChI=1S/C23H31NO2/c1-2-22-10-8-17-16-7-5-15(24-25)12-14(16)4-6-18(17)21(22)19-13-20(19)23(22)9-3-11-26-23/h3,9,12,16-21,25H,2,4-8,10-11,13H2,1H3/b24-15+/t16-,17?,18?,19?,20?,21?,22-,23-/m0/s1 |
| InChIKey | KJJJNTIVLCTFNZ-FZZDZXISSA-N |
| XLogP | 4.96 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|