C24H33NO2 — CID 59617856
CID 59617856 (PubChem CID 59617856) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol.
| Compound Name | CID 59617856 |
|---|---|
| PubChem CID | 59617856 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | — |
| SMILES | CC[C@]12CCC3C4CC/C(=N\O)C=C4CCC3C1CC1(CC1)[C@@]21C=CCO1 |
| InChI | InChI=1S/C24H33NO2/c1-2-23-10-8-19-18-7-5-17(25-26)14-16(18)4-6-20(19)21(23)15-22(11-12-22)24(23)9-3-13-27-24/h3,9,14,18-21,26H,2,4-8,10-13,15H2,1H3/b25-17+/t18?,19?,20?,21?,23-,24-/m0/s1 |
| InChIKey | OOEGUAKIMJYFLB-ARACLDGCSA-N |
| XLogP | 5.49 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|