C23H31NO3 — CID 143324827
[(8R,9S,10R,13S,14S,17S)-13-ethyl-17-ethynyl-3-hydroxyimino-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 143324827) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-13-ethyl-17-ethynyl-3-hydroxyimino-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-13-ethyl-17-ethynyl-3-hydroxyimino-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 143324827 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-13-ethyl-17-ethynyl-3-hydroxyimino-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | C#C[C@@H]1C(OC(C)=O)C[C@H]2[C@@H]3CCC4=CC(=NO)CC[C@@H]4[C@H]3CC[C@]12CC |
| InChI | InChI=1S/C23H31NO3/c1-4-20-22(27-14(3)25)13-21-19-8-6-15-12-16(24-26)7-9-17(15)18(19)10-11-23(20,21)5-2/h1,12,17-22,26H,5-11,13H2,2-3H3/t17-,18+,19+,20+,21-,22?,23+/m0/s1 |
| InChIKey | LHGXWAYEQIGDSF-MGCLAILCSA-N |
| XLogP | 4.57 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|