C22H28O3 — CID 87697302
[(8R,9S,10R,13S,14S,17S)-17-ethynyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 87697302) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-17-ethynyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-17-ethynyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 87697302 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-17-ethynyl-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | C#C[C@@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC(OC(C)=O)[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H28O3/c1-4-15-6-8-19-17-7-5-14-11-16(24)12-20(25-13(2)23)21(14)18(17)9-10-22(15,19)3/h1,11,15,17-21H,5-10,12H2,2-3H3/t15-,17-,18+,19+,20?,21+,22-/m1/s1 |
| InChIKey | KWAFOENGRALFTQ-KOZYEDBJSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|