C21H29NO — CID 70893642
(8R,9S,10S,13S,14S,17R)-1,1,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 70893642) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17R)-1,1,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8R,9S,10S,13S,14S,17R)-1,1,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 70893642 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (8R,9S,10S,13S,14S,17R)-1,1,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | CC1(C)CC(=O)C=C2CC[C@@H]3[C@H](CC[C@]4(C)[C@H](C#N)CC[C@@H]34)[C@H]21 |
| InChI | InChI=1S/C21H29NO/c1-20(2)11-15(23)10-13-4-6-16-17(19(13)20)8-9-21(3)14(12-22)5-7-18(16)21/h10,14,16-19H,4-9,11H2,1-3H3/t14-,16+,17-,18-,19-,21+/m0/s1 |
| InChIKey | RPEBZDWRGPDQRB-IFKPNGQCSA-N |
| XLogP | 4.90 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |