C22H27NO — CID 87569308
(8S,9R,10R,13S,14S)-10,13-dimethyl-6,7-dimethylidene-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 87569308) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-10,13-dimethyl-6,7-dimethylidene-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8S,9R,10R,13S,14S)-10,13-dimethyl-6,7-dimethylidene-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 87569308 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (8S,9R,10R,13S,14S)-10,13-dimethyl-6,7-dimethylidene-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | C=C1C(=C)[C@@H]2[C@@H](CC[C@]3(C)C(C#N)CC[C@@H]23)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C22H27NO/c1-13-14(2)20-17-6-5-15(12-23)21(17,3)10-8-18(20)22(4)9-7-16(24)11-19(13)22/h11,15,17-18,20H,1-2,5-10H2,3-4H3/t15?,17-,18+,20-,21+,22+/m0/s1 |
| InChIKey | WQSCSTXYQCBWAL-NOYHAOBRSA-N |
| XLogP | 4.99 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |