C21H29NO — CID 91071154
(8S,9S,10R,13S,14S,17S)-1,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 91071154) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-1,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8S,9S,10R,13S,14S,17S)-1,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 91071154 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-1,10,13-trimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | CC1CC(=O)C=C2CC[C@H]3[C@@H]4CC[C@H](C#N)[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C21H29NO/c1-13-10-16(23)11-14-4-6-17-18-7-5-15(12-22)20(18,2)9-8-19(17)21(13,14)3/h11,13,15,17-19H,4-10H2,1-3H3/t13?,15-,17+,18+,19+,20-,21+/m1/s1 |
| InChIKey | BTVJHJIKUKLLCS-LLPHUQDKSA-N |
| XLogP | 4.90 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |